C16H18N6 — CID 53189637
7-(4-benzylpiperazin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 53189637) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 7-(4-benzylpiperazin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 7-(4-benzylpiperazin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 53189637 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 7-(4-benzylpiperazin-1-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | c1ccc(CN2CCN(c3cnn4cnnc4c3)CC2)cc1 |
| InChI | InChI=1S/C16H18N6/c1-2-4-14(5-3-1)12-20-6-8-21(9-7-20)15-10-16-19-17-13-22(16)18-11-15/h1-5,10-11,13H,6-9,12H2 |
| InChIKey | SXZVZDFNNGZJEO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |