C13H17N5O2 — CID 53190602
1-(2-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2-methoxyethyl)urea (PubChem CID 53190602) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(2-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2-methoxyethyl)urea.
| Compound Name | 1-(2-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 53190602 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(2-cyclopropyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1cccn2nc(C3CC3)nc12 |
| InChI | InChI=1S/C13H17N5O2/c1-20-8-6-14-13(19)15-10-3-2-7-18-12(10)16-11(17-18)9-4-5-9/h2-3,7,9H,4-6,8H2,1H3,(H2,14,15,19) |
| InChIKey | XDFMTBVMRJKSEG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|