C23H29N7O — CID 53190996
2-methyl-4-piperidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidine-6-carboxamide (PubChem CID 53190996) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-methyl-4-piperidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidine-6-carboxamide.
| Compound Name | 2-methyl-4-piperidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 53190996 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-methyl-4-piperidin-1-yl-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrazolo[3,4-d]pyrimidine-6-carboxamide |
| SMILES | Cn1cc2c(N3CCCCC3)nc(C(=O)NCc3ccc(N4CCCC4)cc3)nc2n1 |
| InChI | InChI=1S/C23H29N7O/c1-28-16-19-20(27-28)25-21(26-22(19)30-13-3-2-4-14-30)23(31)24-15-17-7-9-18(10-8-17)29-11-5-6-12-29/h7-10,16H,2-6,11-15H2,1H3,(H,24,31) |
| InChIKey | CPSNTJVHBXNPOB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|