About [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone
[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 53191151) has the molecular formula C17H18N4OS
and a molecular weight of 326.42 g/mol. Its IUPAC name is [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone.
Molecular Properties
| Compound Name | [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| PubChem CID | 53191151 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CCn1c(C2CCN(C(=O)c3ccsc3)C2)nc2cccnc21 |
| InChI | InChI=1S/C17H18N4OS/c1-2-21-15(19-14-4-3-7-18-16(14)21)12-5-8-20(10-12)17(22)13-6-9-23-11-13/h3-4,6-7,9,11-12H,2,5,8,10H2,1H3 |
| InChIKey | JSKZGNWDZVMUIB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The IUPAC name of [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone (CID 53191151) is [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone.
What is the SMILES notation for [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The canonical SMILES for [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone is CCn1c(C2CCN(C(=O)c3ccsc3)C2)nc2cccnc21.
What is the InChIKey of [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
The InChIKey is JSKZGNWDZVMUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4OS/c1-2-21-15(19-14-4-3-7-18-16(14)21)12-5-8-20(10-12)17(22)13-6-9-23-11-13/h3-4,6-7,9,11-12H,2,5,8,10H2,1H3.
What are the key properties of [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone?
[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone has a molecular weight of 326.42 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]-thiophen-3-ylmethanone is sourced from PubChem (CID 53191151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).