About ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate
ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate (PubChem CID 53191246) has the molecular formula C22H25N5O3
and a molecular weight of 407.47 g/mol. Its IUPAC name is ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate |
| PubChem CID | 53191246 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCC(c3nc4cccnc4n3CC)C2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-3-27-19(25-18-6-5-12-23-20(18)27)16-11-13-26(14-16)22(29)24-17-9-7-15(8-10-17)21(28)30-4-2/h5-10,12,16H,3-4,11,13-14H2,1-2H3,(H,24,29) |
| InChIKey | WOMASODLUICJME-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate?
The IUPAC name of ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate (CID 53191246) is ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate is CCOC(=O)c1ccc(NC(=O)N2CCC(c3nc4cccnc4n3CC)C2)cc1.
What is the InChIKey of ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate?
The InChIKey is WOMASODLUICJME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O3/c1-3-27-19(25-18-6-5-12-23-20(18)27)16-11-13-26(14-16)22(29)24-17-9-7-15(8-10-17)21(28)30-4-2/h5-10,12,16H,3-4,11,13-14H2,1-2H3,(H,24,29).
What are the key properties of ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate?
ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate has a molecular weight of 407.47 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]benzoate is sourced from PubChem (CID 53191246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).