About methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate
methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 53191255) has the molecular formula C19H21N5O3S
and a molecular weight of 399.48 g/mol. Its IUPAC name is methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate |
| PubChem CID | 53191255 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | CCn1c(C2CCN(C(=O)Nc3ccsc3C(=O)OC)C2)nc2cccnc21 |
| InChI | InChI=1S/C19H21N5O3S/c1-3-24-16(21-14-5-4-8-20-17(14)24)12-6-9-23(11-12)19(26)22-13-7-10-28-15(13)18(25)27-2/h4-5,7-8,10,12H,3,6,9,11H2,1-2H3,(H,22,26) |
| InChIKey | OFCLXWHLLAQMJM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate (CID 53191255) is methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate is CCn1c(C2CCN(C(=O)Nc3ccsc3C(=O)OC)C2)nc2cccnc21.
What is the InChIKey of methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate?
The InChIKey is OFCLXWHLLAQMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3S/c1-3-24-16(21-14-5-4-8-20-17(14)24)12-6-9-23(11-12)19(26)22-13-7-10-28-15(13)18(25)27-2/h4-5,7-8,10,12H,3,6,9,11H2,1-2H3,(H,22,26).
What are the key properties of methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate?
methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate has a molecular weight of 399.48 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[3-(3-ethylimidazo[4,5-b]pyridin-2-yl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 53191255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).