About 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one
1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 53192443) has the molecular formula C19H24N4O
and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one |
| PubChem CID | 53192443 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCC(c2nc(C3CC3)n[nH]2)CC1 |
| InChI | InChI=1S/C19H24N4O/c24-17(9-6-14-4-2-1-3-5-14)23-12-10-16(11-13-23)19-20-18(21-22-19)15-7-8-15/h1-5,15-16H,6-13H2,(H,20,21,22) |
| InChIKey | ZLOSNAOMDDVWER-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one?
The IUPAC name of 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one (CID 53192443) is 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one.
What is the SMILES notation for 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one?
The canonical SMILES for 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one is O=C(CCc1ccccc1)N1CCC(c2nc(C3CC3)n[nH]2)CC1.
What is the InChIKey of 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one?
The InChIKey is ZLOSNAOMDDVWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O/c24-17(9-6-14-4-2-1-3-5-14)23-12-10-16(11-13-23)19-20-18(21-22-19)15-7-8-15/h1-5,15-16H,6-13H2,(H,20,21,22).
What are the key properties of 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one?
1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one has a molecular weight of 324.43 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-3-phenylpropan-1-one is sourced from PubChem (CID 53192443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).