About 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine
4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine (PubChem CID 53192491) has the molecular formula C9H16N4
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine.
Molecular Properties
| Compound Name | 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine |
| PubChem CID | 53192491 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine |
| SMILES | CCc1nc(C2CCNCC2)n[nH]1 |
| InChI | InChI=1S/C9H16N4/c1-2-8-11-9(13-12-8)7-3-5-10-6-4-7/h7,10H,2-6H2,1H3,(H,11,12,13) |
| InChIKey | UQXGXVADESAMLD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine?
The IUPAC name of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine (CID 53192491) is 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine.
What is the SMILES notation for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine?
The canonical SMILES for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine is CCc1nc(C2CCNCC2)n[nH]1.
What is the InChIKey of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine?
The InChIKey is UQXGXVADESAMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4/c1-2-8-11-9(13-12-8)7-3-5-10-6-4-7/h7,10H,2-6H2,1H3,(H,11,12,13).
What are the key properties of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine?
4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine has a molecular weight of 180.25 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine is sourced from PubChem (CID 53192491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).