About 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine
4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine (PubChem CID 53192555) has the molecular formula C15H23N5
and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine |
| PubChem CID | 53192555 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine |
| SMILES | CCCn1cnnc1C1CCN(Cc2ccc[nH]2)CC1 |
| InChI | InChI=1S/C15H23N5/c1-2-8-20-12-17-18-15(20)13-5-9-19(10-6-13)11-14-4-3-7-16-14/h3-4,7,12-13,16H,2,5-6,8-11H2,1H3 |
| InChIKey | IGTPLYUQAUIKJJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine?
The IUPAC name of 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine (CID 53192555) is 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine.
What is the SMILES notation for 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine?
The canonical SMILES for 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine is CCCn1cnnc1C1CCN(Cc2ccc[nH]2)CC1.
What is the InChIKey of 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine?
The InChIKey is IGTPLYUQAUIKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5/c1-2-8-20-12-17-18-15(20)13-5-9-19(10-6-13)11-14-4-3-7-16-14/h3-4,7,12-13,16H,2,5-6,8-11H2,1H3.
What are the key properties of 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine?
4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine has a molecular weight of 273.38 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-propyl-1,2,4-triazol-3-yl)-1-(1H-pyrrol-2-ylmethyl)piperidine is sourced from PubChem (CID 53192555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).