About 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine
4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine (PubChem CID 53192919) has the molecular formula C16H18N4S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine.
Molecular Properties
| Compound Name | 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine |
| PubChem CID | 53192919 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine |
| SMILES | c1cc(-c2nc3c(c(N4CCSCC4)n2)CCC3)ccn1 |
| InChI | InChI=1S/C16H18N4S/c1-2-13-14(3-1)18-15(12-4-6-17-7-5-12)19-16(13)20-8-10-21-11-9-20/h4-7H,1-3,8-11H2 |
| InChIKey | COKANGUPROEYFM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine?
The IUPAC name of 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine (CID 53192919) is 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine.
What is the SMILES notation for 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine?
The canonical SMILES for 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine is c1cc(-c2nc3c(c(N4CCSCC4)n2)CCC3)ccn1.
What is the InChIKey of 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine?
The InChIKey is COKANGUPROEYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4S/c1-2-13-14(3-1)18-15(12-4-6-17-7-5-12)19-16(13)20-8-10-21-11-9-20/h4-7H,1-3,8-11H2.
What are the key properties of 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine?
4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine has a molecular weight of 298.41 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)thiomorpholine is sourced from PubChem (CID 53192919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).