About [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol
[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol (PubChem CID 53193338) has the molecular formula C17H24N4O
and a molecular weight of 300.41 g/mol. Its IUPAC name is [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol.
Molecular Properties
| Compound Name | [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol |
| PubChem CID | 53193338 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol |
| SMILES | Cc1c(CN2CCC(C(O)c3ccccn3)CC2)cnn1C |
| InChI | InChI=1S/C17H24N4O/c1-13-15(11-19-20(13)2)12-21-9-6-14(7-10-21)17(22)16-5-3-4-8-18-16/h3-5,8,11,14,17,22H,6-7,9-10,12H2,1-2H3 |
| InChIKey | BTWXDKCMVSJHND-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol?
The IUPAC name of [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol (CID 53193338) is [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol.
What is the SMILES notation for [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol?
The canonical SMILES for [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol is Cc1c(CN2CCC(C(O)c3ccccn3)CC2)cnn1C.
What is the InChIKey of [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol?
The InChIKey is BTWXDKCMVSJHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O/c1-13-15(11-19-20(13)2)12-21-9-6-14(7-10-21)17(22)16-5-3-4-8-18-16/h3-5,8,11,14,17,22H,6-7,9-10,12H2,1-2H3.
What are the key properties of [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol?
[1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol has a molecular weight of 300.41 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]-pyridin-2-ylmethanol is sourced from PubChem (CID 53193338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).