About 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide
1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 53193466) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide |
| PubChem CID | 53193466 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2cnoc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C16H19N3O2/c17-16(20)13-6-8-19(9-7-13)11-14-10-18-21-15(14)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2,(H2,17,20) |
| InChIKey | JSTPNEVPSFBUGD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide?
The IUPAC name of 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide (CID 53193466) is 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide is NC(=O)C1CCN(Cc2cnoc2-c2ccccc2)CC1.
What is the InChIKey of 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide?
The InChIKey is JSTPNEVPSFBUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2/c17-16(20)13-6-8-19(9-7-13)11-14-10-18-21-15(14)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2,(H2,17,20).
What are the key properties of 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide?
1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide has a molecular weight of 285.35 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-phenyl-1,2-oxazol-4-yl)methyl]piperidine-4-carboxamide is sourced from PubChem (CID 53193466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).