C10H18O — CID 5319367
(1S,4R)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol (PubChem CID 5319367) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (1S,4R)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol.
| Compound Name | (1S,4R)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 5319367 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (1S,4R)-1-methyl-4-propan-2-ylcyclohex-2-en-1-ol |
| SMILES | CC(C)[C@@H]1C=C[C@@](C)(O)CC1 |
| InChI | InChI=1S/C10H18O/c1-8(2)9-4-6-10(3,11)7-5-9/h4,6,8-9,11H,5,7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | IZXYHAXVIZHGJV-NXEZZACHSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|