About 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one
4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one (PubChem CID 53193732) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 53193732 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCN1C(=O)CCc2c(C)ncnc21 |
| InChI | InChI=1S/C11H15N3O/c1-3-6-14-10(15)5-4-9-8(2)12-7-13-11(9)14/h7H,3-6H2,1-2H3 |
| InChIKey | HBHCLVNXKDMNSH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one (CID 53193732) is 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one is CCCN1C(=O)CCc2c(C)ncnc21.
What is the InChIKey of 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one?
The InChIKey is HBHCLVNXKDMNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-3-6-14-10(15)5-4-9-8(2)12-7-13-11(9)14/h7H,3-6H2,1-2H3.
What are the key properties of 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one?
4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one has a molecular weight of 205.26 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-8-propyl-5,6-dihydropyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 53193732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).