methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate

C10H13ClN2O2 — CID 53193868

IUPACmethyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate
SMILESCOC(=O)CCc1c(C)nc(C)nc1Cl
InChIInChI=1S/C10H13ClN2O2/c1-6-8(4-5-9(14)15-3)10(11)13-7(2)12-6/h4-5H2,1-3H3
InChIKeyBDGFDLQVNKJSDX-UHFFFAOYSA-N
MW228.68 g/mol
LogP1.85
Rot. Bonds3

About methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate

methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate (PubChem CID 53193868) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate
PubChem CID53193868
Molecular FormulaC10H13ClN2O2
Molecular Weight228.68 g/mol
Exact Mass228.07
IUPAC Namemethyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate
SMILESCOC(=O)CCc1c(C)nc(C)nc1Cl
InChIInChI=1S/C10H13ClN2O2/c1-6-8(4-5-9(14)15-3)10(11)13-7(2)12-6/h4-5H2,1-3H3
InChIKeyBDGFDLQVNKJSDX-UHFFFAOYSA-N
XLogP1.85
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.68
LogP ≤ 51.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate?
The IUPAC name of methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate (CID 53193868) is methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate.
What is the SMILES notation for methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate?
The canonical SMILES for methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate is COC(=O)CCc1c(C)nc(C)nc1Cl.
What is the InChIKey of methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate?
The InChIKey is BDGFDLQVNKJSDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2O2/c1-6-8(4-5-9(14)15-3)10(11)13-7(2)12-6/h4-5H2,1-3H3.
What are the key properties of methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate?
methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate has a molecular weight of 228.68 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-chloro-2,6-dimethylpyrimidin-5-yl)propanoate is sourced from PubChem (CID 53193868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).