About [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate
[4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate (PubChem CID 5319395) has the molecular formula C25H38O5
and a molecular weight of 418.57 g/mol. Its IUPAC name is [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate.
Molecular Properties
| Compound Name | [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate |
| PubChem CID | 5319395 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate |
| SMILES | CCCC/C=C\CCCCCCCCCC1=C(OC)C(=O)C(C)=C(OC(C)=O)C1=O |
| InChI | InChI=1S/C25H38O5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-23(28)24(30-20(3)26)19(2)22(27)25(21)29-4/h8-9H,5-7,10-18H2,1-4H3/b9-8- |
| InChIKey | GQGSZVZNLTULMP-HJWRWDBZSA-N |
| XLogP | 6.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate?
The IUPAC name of [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate (CID 5319395) is [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate.
What is the SMILES notation for [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate?
The canonical SMILES for [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate is CCCC/C=C\CCCCCCCCCC1=C(OC)C(=O)C(C)=C(OC(C)=O)C1=O.
What is the InChIKey of [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate?
The InChIKey is GQGSZVZNLTULMP-HJWRWDBZSA-N. The full InChI is InChI=1S/C25H38O5/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-23(28)24(30-20(3)26)19(2)22(27)25(21)29-4/h8-9H,5-7,10-18H2,1-4H3/b9-8-.
What are the key properties of [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate?
[4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate has a molecular weight of 418.57 g/mol, XLogP of 6.13, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-2-methyl-3,6-dioxo-5-[(Z)-pentadec-10-enyl]cyclohexa-1,4-dien-1-yl] acetate is sourced from PubChem (CID 5319395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).