About 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one
7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one (PubChem CID 5319406) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one.
Molecular Properties
| Compound Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one |
| PubChem CID | 5319406 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one |
| SMILES | COc1cc2ccc(=O)oc2cc1OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)10-11-23-19-13-17-16(12-18(19)22-4)8-9-20(21)24-17/h6,8-10,12-13H,5,7,11H2,1-4H3/b15-10+ |
| InChIKey | NLNMITFNBJXRRP-XNTDXEJSSA-N |
| XLogP | 4.87 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one?
The IUPAC name of 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one (CID 5319406) is 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one.
What is the SMILES notation for 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one?
The canonical SMILES for 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one is COc1cc2ccc(=O)oc2cc1OC/C=C(\C)CCC=C(C)C.
What is the InChIKey of 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one?
The InChIKey is NLNMITFNBJXRRP-XNTDXEJSSA-N. The full InChI is InChI=1S/C20H24O4/c1-14(2)6-5-7-15(3)10-11-23-19-13-17-16(12-18(19)22-4)8-9-20(21)24-17/h6,8-10,12-13H,5,7,11H2,1-4H3/b15-10+.
What are the key properties of 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one?
7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one has a molecular weight of 328.41 g/mol, XLogP of 4.87, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-6-methoxychromen-2-one is sourced from PubChem (CID 5319406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).