C20H29FN4O3 — CID 53195119
4-[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-N-(2-methoxyethyl)-1,4-diazepane-1-carboxamide (PubChem CID 53195119) has the molecular formula C20H29FN4O3 and a molecular weight of 392.48 g/mol. Its IUPAC name is 4-[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-N-(2-methoxyethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-N-(2-methoxyethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 53195119 |
| Molecular Formula | C20H29FN4O3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-[1-[(4-fluorophenyl)methyl]-2-oxopyrrolidin-3-yl]-N-(2-methoxyethyl)-1,4-diazepane-1-carboxamide |
| SMILES | COCCNC(=O)N1CCCN(C2CCN(Cc3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C20H29FN4O3/c1-28-14-8-22-20(27)24-10-2-9-23(12-13-24)18-7-11-25(19(18)26)15-16-3-5-17(21)6-4-16/h3-6,18H,2,7-15H2,1H3,(H,22,27) |
| InChIKey | QRAOXOPMNDLFPD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|