About N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide
N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 53195131) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 53195131 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2nc(C)oc2C)cc1 |
| InChI | InChI=1S/C14H16N2O3/c1-4-18-12-7-5-11(6-8-12)16-14(17)13-9(2)19-10(3)15-13/h5-8H,4H2,1-3H3,(H,16,17) |
| InChIKey | UYHCYVCSZMIUCT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide (CID 53195131) is N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide is CCOc1ccc(NC(=O)c2nc(C)oc2C)cc1.
What is the InChIKey of N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide?
The InChIKey is UYHCYVCSZMIUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-4-18-12-7-5-11(6-8-12)16-14(17)13-9(2)19-10(3)15-13/h5-8H,4H2,1-3H3,(H,16,17).
What are the key properties of N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide?
N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide has a molecular weight of 260.29 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxyphenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 53195131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).