C12H10F2N2O2 — CID 53195145
N-(2,5-difluorophenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide (PubChem CID 53195145) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53195145 |
| Molecular Formula | C12H10F2N2O2 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-2,5-dimethyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cc(F)ccc2F)c(C)o1 |
| InChI | InChI=1S/C12H10F2N2O2/c1-6-11(15-7(2)18-6)12(17)16-10-5-8(13)3-4-9(10)14/h3-5H,1-2H3,(H,16,17) |
| InChIKey | XIPYLKQILFLTKO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |