About 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide
2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 53195156) has the molecular formula C13H11F3N2O3
and a molecular weight of 300.24 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 53195156 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c(C)o1 |
| InChI | InChI=1S/C13H11F3N2O3/c1-7-11(17-8(2)20-7)12(19)18-9-3-5-10(6-4-9)21-13(14,15)16/h3-6H,1-2H3,(H,18,19) |
| InChIKey | QOZUSSNOUGCAOH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide (CID 53195156) is 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide is Cc1nc(C(=O)Nc2ccc(OC(F)(F)F)cc2)c(C)o1.
What is the InChIKey of 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide?
The InChIKey is QOZUSSNOUGCAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O3/c1-7-11(17-8(2)20-7)12(19)18-9-3-5-10(6-4-9)21-13(14,15)16/h3-6H,1-2H3,(H,18,19).
What are the key properties of 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide?
2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide has a molecular weight of 300.24 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-N-[4-(trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 53195156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).