C11H18N2O2 — CID 53195169
N-butyl-N,2,5-trimethyl-1,3-oxazole-4-carboxamide (PubChem CID 53195169) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-butyl-N,2,5-trimethyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-N,2,5-trimethyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53195169 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-butyl-N,2,5-trimethyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1nc(C)oc1C |
| InChI | InChI=1S/C11H18N2O2/c1-5-6-7-13(4)11(14)10-8(2)15-9(3)12-10/h5-7H2,1-4H3 |
| InChIKey | BHVUMGJMPARXOM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |