About N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide
N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide (PubChem CID 53195259) has the molecular formula C16H24N4O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide |
| PubChem CID | 53195259 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCN(Cc1cn(C)nc1C)C(=O)c1nc(C(C)C)oc1C |
| InChI | InChI=1S/C16H24N4O2/c1-7-20(9-13-8-19(6)18-11(13)4)16(21)14-12(5)22-15(17-14)10(2)3/h8,10H,7,9H2,1-6H3 |
| InChIKey | ZONVXHLKESPNPG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide (CID 53195259) is N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide is CCN(Cc1cn(C)nc1C)C(=O)c1nc(C(C)C)oc1C.
What is the InChIKey of N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide?
The InChIKey is ZONVXHLKESPNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2/c1-7-20(9-13-8-19(6)18-11(13)4)16(21)14-12(5)22-15(17-14)10(2)3/h8,10H,7,9H2,1-6H3.
What are the key properties of N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide?
N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide has a molecular weight of 304.39 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethylpyrazol-4-yl)methyl]-N-ethyl-5-methyl-2-propan-2-yl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 53195259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).