About (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone
(2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone (PubChem CID 53195327) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
| PubChem CID | 53195327 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone |
| SMILES | Cc1oc(C2CCC2)nc1C(=O)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-17(21-18(24-13)14-6-4-7-14)19(23)22-11-3-2-9-16(22)15-8-5-10-20-12-15/h5,8,10,12,14,16H,2-4,6-7,9,11H2,1H3 |
| InChIKey | QWYITVJXBLPXFN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone?
The IUPAC name of (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone (CID 53195327) is (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone.
What is the SMILES notation for (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone?
The canonical SMILES for (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone is Cc1oc(C2CCC2)nc1C(=O)N1CCCCC1c1cccnc1.
What is the InChIKey of (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone?
The InChIKey is QWYITVJXBLPXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-13-17(21-18(24-13)14-6-4-7-14)19(23)22-11-3-2-9-16(22)15-8-5-10-20-12-15/h5,8,10,12,14,16H,2-4,6-7,9,11H2,1H3.
What are the key properties of (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone?
(2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone has a molecular weight of 325.41 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclobutyl-5-methyl-1,3-oxazol-4-yl)-(2-pyridin-3-ylpiperidin-1-yl)methanone is sourced from PubChem (CID 53195327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).