About N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide
N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide (PubChem CID 53195579) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 53195579 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1nc(CNC(=O)c2ccoc2)oc1C |
| InChI | InChI=1S/C15H19N3O4/c1-4-18(5-2)15(20)13-10(3)22-12(17-13)8-16-14(19)11-6-7-21-9-11/h6-7,9H,4-5,8H2,1-3H3,(H,16,19) |
| InChIKey | BDYYNBIJXDCPIW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide?
The IUPAC name of N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide (CID 53195579) is N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide is CCN(CC)C(=O)c1nc(CNC(=O)c2ccoc2)oc1C.
What is the InChIKey of N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide?
The InChIKey is BDYYNBIJXDCPIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4/c1-4-18(5-2)15(20)13-10(3)22-12(17-13)8-16-14(19)11-6-7-21-9-11/h6-7,9H,4-5,8H2,1-3H3,(H,16,19).
What are the key properties of N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide?
N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide has a molecular weight of 305.33 g/mol, XLogP of 1.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-[(furan-3-carbonylamino)methyl]-5-methyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 53195579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).