C22H20ClN5O — CID 53196890
3-(4-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide (PubChem CID 53196890) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 53196890 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-7-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2ccn3c(-c4ccc(Cl)cc4)nnc3c2)cc1 |
| InChI | InChI=1S/C22H20ClN5O/c1-27(2)19-9-3-15(4-10-19)14-24-22(29)17-11-12-28-20(13-17)25-26-21(28)16-5-7-18(23)8-6-16/h3-13H,14H2,1-2H3,(H,24,29) |
| InChIKey | QTXOEKHAMXSECY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|