C22H24ClN3O2 — CID 53197676
1-[2-(5-chloro-2-hydroxyphenyl)-4-phenyl-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone (PubChem CID 53197676) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-hydroxyphenyl)-4-phenyl-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone.
| Compound Name | 1-[2-(5-chloro-2-hydroxyphenyl)-4-phenyl-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
|---|---|
| PubChem CID | 53197676 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[2-(5-chloro-2-hydroxyphenyl)-4-phenyl-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CC1)N=C(c1ccccc1)CC(c1cc(Cl)ccc1O)N2 |
| InChI | InChI=1S/C22H24ClN3O2/c1-15(27)26-11-9-22(10-12-26)24-19(16-5-3-2-4-6-16)14-20(25-22)18-13-17(23)7-8-21(18)28/h2-8,13,20,25,28H,9-12,14H2,1H3 |
| InChIKey | UIQJWTUJGGLAJE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|