C23H28ClN3O2 — CID 53197685
4-chloro-2-[4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 53197685) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 4-chloro-2-[4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 4-chloro-2-[4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 53197685 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4-chloro-2-[4-(4-ethoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | CCOc1ccc(C2=NC3(CCN(C)CC3)NC(c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-3-29-18-7-4-16(5-8-18)20-15-21(19-14-17(24)6-9-22(19)28)26-23(25-20)10-12-27(2)13-11-23/h4-9,14,21,26,28H,3,10-13,15H2,1-2H3 |
| InChIKey | MOYMXBJHIAOKKU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|