C22H26ClN3O2 — CID 53197689
4-chloro-2-[4-(3-methoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 53197689) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 4-chloro-2-[4-(3-methoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 4-chloro-2-[4-(3-methoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 53197689 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-chloro-2-[4-(3-methoxyphenyl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | COc1cccc(C2=NC3(CCN(C)CC3)NC(c3cc(Cl)ccc3O)C2)c1 |
| InChI | InChI=1S/C22H26ClN3O2/c1-26-10-8-22(9-11-26)24-19(15-4-3-5-17(12-15)28-2)14-20(25-22)18-13-16(23)6-7-21(18)27/h3-7,12-13,20,25,27H,8-11,14H2,1-2H3 |
| InChIKey | BPPMQQBBBGHHOZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|