C22H24ClN3O3 — CID 53197691
2-[4-(1,3-benzodioxol-5-yl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol (PubChem CID 53197691) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 53197691 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-9-methyl-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]-4-chlorophenol |
| SMILES | CN1CCC2(CC1)N=C(c1ccc3c(c1)OCO3)CC(c1cc(Cl)ccc1O)N2 |
| InChI | InChI=1S/C22H24ClN3O3/c1-26-8-6-22(7-9-26)24-17(14-2-5-20-21(10-14)29-13-28-20)12-18(25-22)16-11-15(23)3-4-19(16)27/h2-5,10-11,18,25,27H,6-9,12-13H2,1H3 |
| InChIKey | MKAQNJMVSVATHS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|