C22H26BrN3O — CID 53197704
4-bromo-2-[9-methyl-4-(4-methylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol (PubChem CID 53197704) has the molecular formula C22H26BrN3O and a molecular weight of 428.37 g/mol. Its IUPAC name is 4-bromo-2-[9-methyl-4-(4-methylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol.
| Compound Name | 4-bromo-2-[9-methyl-4-(4-methylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 53197704 |
| Molecular Formula | C22H26BrN3O |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 4-bromo-2-[9-methyl-4-(4-methylphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-2-yl]phenol |
| SMILES | Cc1ccc(C2=NC3(CCN(C)CC3)NC(c3cc(Br)ccc3O)C2)cc1 |
| InChI | InChI=1S/C22H26BrN3O/c1-15-3-5-16(6-4-15)19-14-20(18-13-17(23)7-8-21(18)27)25-22(24-19)9-11-26(2)12-10-22/h3-8,13,20,25,27H,9-12,14H2,1-2H3 |
| InChIKey | IEYMMXJTHXCUSN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|