About 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate
1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate (PubChem CID 5319879) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate |
| PubChem CID | 5319879 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)CO |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | UPWGQKDVAURUGE-KTKRTIGZSA-N |
| XLogP | 4.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate?
The IUPAC name of 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate (CID 5319879) is 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate.
What is the SMILES notation for 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate?
The canonical SMILES for 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)CO.
What is the InChIKey of 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate?
The InChIKey is UPWGQKDVAURUGE-KTKRTIGZSA-N. The full InChI is InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9-.
What are the key properties of 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate?
1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate has a molecular weight of 356.55 g/mol, XLogP of 4.92, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroxypropan-2-yl (Z)-octadec-9-enoate is sourced from PubChem (CID 5319879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).