About 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene
3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene (PubChem CID 5319970) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene.
Molecular Properties
| Compound Name | 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
| PubChem CID | 5319970 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene |
| SMILES | CC1CCCCCCCCc2cccc(n2)C1 |
| InChI | InChI=1S/C16H25N/c1-14-9-6-4-2-3-5-7-10-15-11-8-12-16(13-14)17-15/h8,11-12,14H,2-7,9-10,13H2,1H3 |
| InChIKey | IMNKABOILQOFDL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene?
The IUPAC name of 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene (CID 5319970) is 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene.
What is the SMILES notation for 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene?
The canonical SMILES for 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene is CC1CCCCCCCCc2cccc(n2)C1.
What is the InChIKey of 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene?
The InChIKey is IMNKABOILQOFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-14-9-6-4-2-3-5-7-10-15-11-8-12-16(13-14)17-15/h8,11-12,14H,2-7,9-10,13H2,1H3.
What are the key properties of 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene?
3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene has a molecular weight of 231.38 g/mol, XLogP of 4.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-16-azabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene is sourced from PubChem (CID 5319970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).