About 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde
1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde (PubChem CID 5320212) has the molecular formula C15H8O6
and a molecular weight of 284.22 g/mol. Its IUPAC name is 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde.
Molecular Properties
| Compound Name | 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde |
| PubChem CID | 5320212 |
| Molecular Formula | C15H8O6 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde |
| SMILES | O=Cc1c(O)cc2c(c1O)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C15H8O6/c16-5-8-10(18)4-7-12(15(8)21)13(19)6-2-1-3-9(17)11(6)14(7)20/h1-5,17-18,21H |
| InChIKey | ZLTPIJXBXKYZKU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde?
The IUPAC name of 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde (CID 5320212) is 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde.
What is the SMILES notation for 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde?
The canonical SMILES for 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde is O=Cc1c(O)cc2c(c1O)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde?
The InChIKey is ZLTPIJXBXKYZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O6/c16-5-8-10(18)4-7-12(15(8)21)13(19)6-2-1-3-9(17)11(6)14(7)20/h1-5,17-18,21H.
What are the key properties of 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde?
1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde has a molecular weight of 284.22 g/mol, XLogP of 1.39, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trihydroxy-9,10-dioxoanthracene-2-carbaldehyde is sourced from PubChem (CID 5320212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).