C18H30N4O2 — CID 53202190
N-butyl-N-methyl-1-(6-oxo-1-propylpyridazin-4-yl)piperidine-4-carboxamide (PubChem CID 53202190) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is N-butyl-N-methyl-1-(6-oxo-1-propylpyridazin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-butyl-N-methyl-1-(6-oxo-1-propylpyridazin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53202190 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | N-butyl-N-methyl-1-(6-oxo-1-propylpyridazin-4-yl)piperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(c2cnn(CCC)c(=O)c2)CC1 |
| InChI | InChI=1S/C18H30N4O2/c1-4-6-10-20(3)18(24)15-7-11-21(12-8-15)16-13-17(23)22(9-5-2)19-14-16/h13-15H,4-12H2,1-3H3 |
| InChIKey | MGWLFDHYLUBLGQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |