C22H27ClN6O — CID 53203117
1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide (PubChem CID 53203117) has the molecular formula C22H27ClN6O and a molecular weight of 426.95 g/mol. Its IUPAC name is 1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53203117 |
| Molecular Formula | C22H27ClN6O |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-N-[3-(N-methylanilino)propyl]piperidine-4-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCN(c2nnc3ccc(Cl)cn23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H27ClN6O/c1-27(19-6-3-2-4-7-19)13-5-12-24-21(30)17-10-14-28(15-11-17)22-26-25-20-9-8-18(23)16-29(20)22/h2-4,6-9,16-17H,5,10-15H2,1H3,(H,24,30) |
| InChIKey | VOXOYDIJAZBZNM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|