About N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide
N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide (PubChem CID 532036) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide |
| PubChem CID | 532036 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)12(15)14-10-8-9(16-4)6-7-11(10)17-5/h6-8H,1-5H3,(H,14,15) |
| InChIKey | ZDMQBPDGIJATFQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide (CID 532036) is N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide is COc1ccc(OC)c(NC(=O)C(C)(C)C)c1.
What is the InChIKey of N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide?
The InChIKey is ZDMQBPDGIJATFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-13(2,3)12(15)14-10-8-9(16-4)6-7-11(10)17-5/h6-8H,1-5H3,(H,14,15).
What are the key properties of N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide?
N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide has a molecular weight of 237.30 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethoxyphenyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 532036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).