About (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol
(3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol (PubChem CID 5320396) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol.
Molecular Properties
| Compound Name | (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol |
| PubChem CID | 5320396 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol |
| SMILES | C=C[C@@H](O)C#CC#CCC1OC1CCCCCCC |
| InChI | InChI=1S/C17H24O2/c1-3-5-6-7-10-13-16-17(19-16)14-11-8-9-12-15(18)4-2/h4,15-18H,2-3,5-7,10,13-14H2,1H3/t15-,16?,17?/m1/s1 |
| InChIKey | GVLDSGIQZAFIAN-KLAILNCOSA-N |
| XLogP | 3.06 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol?
The IUPAC name of (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol (CID 5320396) is (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol.
What is the SMILES notation for (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol?
The canonical SMILES for (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol is C=C[C@@H](O)C#CC#CCC1OC1CCCCCCC.
What is the InChIKey of (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol?
The InChIKey is GVLDSGIQZAFIAN-KLAILNCOSA-N. The full InChI is InChI=1S/C17H24O2/c1-3-5-6-7-10-13-16-17(19-16)14-11-8-9-12-15(18)4-2/h4,15-18H,2-3,5-7,10,13-14H2,1H3/t15-,16?,17?/m1/s1.
What are the key properties of (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol?
(3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol has a molecular weight of 260.38 g/mol, XLogP of 3.06, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-8-(3-heptyloxiran-2-yl)oct-1-en-4,6-diyn-3-ol is sourced from PubChem (CID 5320396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).