About 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one (PubChem CID 5320424) has the molecular formula C15H22O
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one.
Analyze 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one?
The IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one (CID 5320424) is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one.
What is the SMILES notation for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one?
The canonical SMILES for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one is CC1=C2C(=O)C3CCC(C)C2(CC1)C3(C)C.
What is the InChIKey of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one?
The InChIKey is JAWSHISYWRRQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O/c1-9-7-8-15-10(2)5-6-11(14(15,3)4)13(16)12(9)15/h10-11H,5-8H2,1-4H3.
What are the key properties of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one?
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one has a molecular weight of 218.34 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undec-4-en-6-one is sourced from PubChem (CID 5320424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).