About 5,6-dimethoxy-3H-1,3-benzoxazol-2-one
5,6-dimethoxy-3H-1,3-benzoxazol-2-one (PubChem CID 5320491) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is 5,6-dimethoxy-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 5,6-dimethoxy-3H-1,3-benzoxazol-2-one |
| PubChem CID | 5320491 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5,6-dimethoxy-3H-1,3-benzoxazol-2-one |
| SMILES | COc1cc2[nH]c(=O)oc2cc1OC |
| InChI | InChI=1S/C9H9NO4/c1-12-7-3-5-6(4-8(7)13-2)14-9(11)10-5/h3-4H,1-2H3,(H,10,11) |
| InChIKey | GSVPAQDMBSXJEG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethoxy-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-3H-1,3-benzoxazol-2-one?
The IUPAC name of 5,6-dimethoxy-3H-1,3-benzoxazol-2-one (CID 5320491) is 5,6-dimethoxy-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 5,6-dimethoxy-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 5,6-dimethoxy-3H-1,3-benzoxazol-2-one is COc1cc2[nH]c(=O)oc2cc1OC.
What is the InChIKey of 5,6-dimethoxy-3H-1,3-benzoxazol-2-one?
The InChIKey is GSVPAQDMBSXJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c1-12-7-3-5-6(4-8(7)13-2)14-9(11)10-5/h3-4H,1-2H3,(H,10,11).
What are the key properties of 5,6-dimethoxy-3H-1,3-benzoxazol-2-one?
5,6-dimethoxy-3H-1,3-benzoxazol-2-one has a molecular weight of 195.17 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 5320491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).