C34H30O9 — CID 5320527
7-hydroxy-2-(2-phenylethyl)-6-[[(6S,7R)-6,7,8-trihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl]oxy]chromen-4-one (PubChem CID 5320527) has the molecular formula C34H30O9 and a molecular weight of 582.61 g/mol. Its IUPAC name is 7-hydroxy-2-(2-phenylethyl)-6-[[(6S,7R)-6,7,8-trihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl]oxy]chromen-4-one.
| Compound Name | 7-hydroxy-2-(2-phenylethyl)-6-[[(6S,7R)-6,7,8-trihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl]oxy]chromen-4-one |
|---|---|
| PubChem CID | 5320527 |
| Molecular Formula | C34H30O9 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 7-hydroxy-2-(2-phenylethyl)-6-[[(6S,7R)-6,7,8-trihydroxy-4-oxo-2-(2-phenylethyl)-5,6,7,8-tetrahydrochromen-5-yl]oxy]chromen-4-one |
| SMILES | O=c1cc(CCc2ccccc2)oc2c1C(Oc1cc3c(=O)cc(CCc4ccccc4)oc3cc1O)[C@@H](O)[C@@H](O)C2O |
| InChI | InChI=1S/C34H30O9/c35-24-15-21(13-11-19-7-3-1-4-8-19)41-27-18-25(36)28(17-23(24)27)43-34-29-26(37)16-22(14-12-20-9-5-2-6-10-20)42-33(29)31(39)30(38)32(34)40/h1-10,15-18,30-32,34,36,38-40H,11-14H2/t30-,31?,32-,34?/m0/s1 |
| InChIKey | MVYHDKFAVRZLQI-LXWJTEAESA-N |
| XLogP | 3.91 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |