C11H8F7NO2 — CID 532102
2,2,3,3,4,4,4-heptafluoro-N-(4-methoxyphenyl)butanamide (PubChem CID 532102) has the molecular formula C11H8F7NO2 and a molecular weight of 319.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxyphenyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 532102 |
| Molecular Formula | C11H8F7NO2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F7NO2/c1-21-7-4-2-6(3-5-7)19-8(20)9(12,13)10(14,15)11(16,17)18/h2-5H,1H3,(H,19,20) |
| InChIKey | DQKFVVPVNVSDOM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|