C21H17ClN2O3S — CID 53210410
5-[3-[(3-chloro-4-methoxyanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid (PubChem CID 53210410) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 5-[3-[(3-chloro-4-methoxyanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(3-chloro-4-methoxyanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 53210410 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 5-[3-[(3-chloro-4-methoxyanilino)methyl]indol-1-yl]thiophene-2-carboxylic acid |
| SMILES | COc1ccc(NCc2cn(-c3ccc(C(=O)O)s3)c3ccccc23)cc1Cl |
| InChI | InChI=1S/C21H17ClN2O3S/c1-27-18-7-6-14(10-16(18)22)23-11-13-12-24(17-5-3-2-4-15(13)17)20-9-8-19(28-20)21(25)26/h2-10,12,23H,11H2,1H3,(H,25,26) |
| InChIKey | YIGBSCGPEKPVCI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|