C17H25NO — CID 5321102
(2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide (PubChem CID 5321102) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide.
| Compound Name | (2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide |
|---|---|
| PubChem CID | 5321102 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2E,4E,8Z,10E,12E)-N-propan-2-yltetradeca-2,4,8,10,12-pentaenamide |
| SMILES | C/C=C/C=C/C=C\CC/C=C/C=C/C(=O)NC(C)C |
| InChI | InChI=1S/C17H25NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(19)18-16(2)3/h4-9,12-16H,10-11H2,1-3H3,(H,18,19)/b5-4+,7-6+,9-8-,13-12+,15-14+ |
| InChIKey | PSKIOIDCXFHNJA-JDXPBYPHSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|