About (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one
(3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one (PubChem CID 5321250) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one.
Molecular Properties
| Compound Name | (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one |
| PubChem CID | 5321250 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one |
| SMILES | CCCC[C@]1(O)OC(=O)C2=C1CCC=C2 |
| InChI | InChI=1S/C12H16O3/c1-2-3-8-12(14)10-7-5-4-6-9(10)11(13)15-12/h4,6,14H,2-3,5,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | JGIFAEPLZJPSHA-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one?
The IUPAC name of (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one (CID 5321250) is (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one.
What is the SMILES notation for (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one?
The canonical SMILES for (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one is CCCC[C@]1(O)OC(=O)C2=C1CCC=C2.
What is the InChIKey of (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one?
The InChIKey is JGIFAEPLZJPSHA-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-3-8-12(14)10-7-5-4-6-9(10)11(13)15-12/h4,6,14H,2-3,5,7-8H2,1H3/t12-/m0/s1.
What are the key properties of (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one?
(3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one has a molecular weight of 208.26 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-butyl-3-hydroxy-4,5-dihydro-2-benzofuran-1-one is sourced from PubChem (CID 5321250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).