C14H15N3O4 — CID 53212558
2-(4-ethyl-12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanoic acid (PubChem CID 53212558) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-(4-ethyl-12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanoic acid.
| Compound Name | 2-(4-ethyl-12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanoic acid |
|---|---|
| PubChem CID | 53212558 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(4-ethyl-12-methyl-9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanoic acid |
| SMILES | CCc1cc2c(cc3c(=O)n(C(C)C(=O)O)nc(C)n32)o1 |
| InChI | InChI=1S/C14H15N3O4/c1-4-9-5-10-12(21-9)6-11-13(18)17(7(2)14(19)20)15-8(3)16(10)11/h5-7H,4H2,1-3H3,(H,19,20) |
| InChIKey | KQSCXIPXZBVGKR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |