About N-(3-chlorophenyl)-2,2,2-trifluoroacetamide
N-(3-chlorophenyl)-2,2,2-trifluoroacetamide (PubChem CID 532127) has the molecular formula C8H5ClF3NO
and a molecular weight of 223.58 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 532127 |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | N-(3-chlorophenyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF3NO/c9-5-2-1-3-6(4-5)13-7(14)8(10,11)12/h1-4H,(H,13,14) |
| InChIKey | VRKVCIVKSRGSLU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3-chlorophenyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(3-chlorophenyl)-2,2,2-trifluoroacetamide (CID 532127) is N-(3-chlorophenyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(3-chlorophenyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(3-chlorophenyl)-2,2,2-trifluoroacetamide is O=C(Nc1cccc(Cl)c1)C(F)(F)F.
What is the InChIKey of N-(3-chlorophenyl)-2,2,2-trifluoroacetamide?
The InChIKey is VRKVCIVKSRGSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF3NO/c9-5-2-1-3-6(4-5)13-7(14)8(10,11)12/h1-4H,(H,13,14).
What are the key properties of N-(3-chlorophenyl)-2,2,2-trifluoroacetamide?
N-(3-chlorophenyl)-2,2,2-trifluoroacetamide has a molecular weight of 223.58 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 532127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).