C10H13NO2 — CID 53212899
8-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine (PubChem CID 53212899) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 8-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine.
| Compound Name | 8-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine |
|---|---|
| PubChem CID | 53212899 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 8-methoxy-2,3,4,5-tetrahydro-1,4-benzoxazepine |
| SMILES | COc1ccc2c(c1)OCCNC2 |
| InChI | InChI=1S/C10H13NO2/c1-12-9-3-2-8-7-11-4-5-13-10(8)6-9/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | YCWLGZVKXHEITQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |