C9H9ClN4 — CID 53213130
4-chloro-6,7,8,9-tetrahydropurino[9,8-a]pyridine (PubChem CID 53213130) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 4-chloro-6,7,8,9-tetrahydropurino[9,8-a]pyridine.
| Compound Name | 4-chloro-6,7,8,9-tetrahydropurino[9,8-a]pyridine |
|---|---|
| PubChem CID | 53213130 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-chloro-6,7,8,9-tetrahydropurino[9,8-a]pyridine |
| SMILES | Clc1ncnc2c1nc1n2CCCC1 |
| InChI | InChI=1S/C9H9ClN4/c10-8-7-9(12-5-11-8)14-4-2-1-3-6(14)13-7/h5H,1-4H2 |
| InChIKey | BXUAHIZVMYTRKV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |