About 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid
4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid (PubChem CID 53213452) has the molecular formula C12H14N4O3
and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid |
| PubChem CID | 53213452 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid |
| SMILES | O=C(O)c1noc2ncnc(N3CCCCCC3)c12 |
| InChI | InChI=1S/C12H14N4O3/c17-12(18)9-8-10(13-7-14-11(8)19-15-9)16-5-3-1-2-4-6-16/h7H,1-6H2,(H,17,18) |
| InChIKey | LSEUZEOPZKCIGU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid?
The IUPAC name of 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid (CID 53213452) is 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid.
What is the SMILES notation for 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid?
The canonical SMILES for 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid is O=C(O)c1noc2ncnc(N3CCCCCC3)c12.
What is the InChIKey of 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid?
The InChIKey is LSEUZEOPZKCIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3/c17-12(18)9-8-10(13-7-14-11(8)19-15-9)16-5-3-1-2-4-6-16/h7H,1-6H2,(H,17,18).
What are the key properties of 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid?
4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid has a molecular weight of 262.27 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azepan-1-yl)-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid is sourced from PubChem (CID 53213452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).